C12H18N2O — CID 138569425
1-[(3E,5Z)-5-ethylocta-1,3,5,7-tetraen-4-yl]-3-methylurea (PubChem CID 138569425) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-[(3E,5Z)-5-ethylocta-1,3,5,7-tetraen-4-yl]-3-methylurea.
| Compound Name | 1-[(3E,5Z)-5-ethylocta-1,3,5,7-tetraen-4-yl]-3-methylurea |
|---|---|
| PubChem CID | 138569425 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 1-[(3E,5Z)-5-ethylocta-1,3,5,7-tetraen-4-yl]-3-methylurea |
| SMILES | C=C/C=C(CC)\C(=C/C=C)NC(=O)NC |
| InChI | InChI=1S/C12H18N2O/c1-5-8-10(7-3)11(9-6-2)14-12(15)13-4/h5-6,8-9H,1-2,7H2,3-4H3,(H2,13,14,15)/b10-8-,11-9+ |
| InChIKey | XNRFYYXMCDQQMT-PNQPDEHRSA-N |
| XLogP | 2.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|