C10H15NO — CID 177208233
N-[(3Z)-3-ethylhexa-1,3,5-trien-2-yl]acetamide (PubChem CID 177208233) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is N-[(3Z)-3-ethylhexa-1,3,5-trien-2-yl]acetamide.
| Compound Name | N-[(3Z)-3-ethylhexa-1,3,5-trien-2-yl]acetamide |
|---|---|
| PubChem CID | 177208233 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | N-[(3Z)-3-ethylhexa-1,3,5-trien-2-yl]acetamide |
| SMILES | C=C/C=C(/CC)C(=C)NC(C)=O |
| InChI | InChI=1S/C10H15NO/c1-5-7-10(6-2)8(3)11-9(4)12/h5,7H,1,3,6H2,2,4H3,(H,11,12)/b10-7- |
| InChIKey | ZZTQBGCKRLUMIM-YFHOEESVSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|