C8H11NO3 — CID 101173964
methyl (2E)-2-acetamidopenta-2,4-dienoate (PubChem CID 101173964) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is methyl (2E)-2-acetamidopenta-2,4-dienoate.
| Compound Name | methyl (2E)-2-acetamidopenta-2,4-dienoate |
|---|---|
| PubChem CID | 101173964 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | methyl (2E)-2-acetamidopenta-2,4-dienoate |
| SMILES | C=C/C=C(/NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C8H11NO3/c1-4-5-7(8(11)12-3)9-6(2)10/h4-5H,1H2,2-3H3,(H,9,10)/b7-5+ |
| InChIKey | DRLOHFUGXAHKLH-FNORWQNLSA-N |
| XLogP | 0.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|