C15H24N2O6 — CID 143525335
methane;methyl (2Z)-2-acetamidopenta-2,4-dienoate;methyl 2-acetamidoprop-2-enoate (PubChem CID 143525335) has the molecular formula C15H24N2O6 and a molecular weight of 328.37 g/mol. Its IUPAC name is methane;methyl (2Z)-2-acetamidopenta-2,4-dienoate;methyl 2-acetamidoprop-2-enoate.
| Compound Name | methane;methyl (2Z)-2-acetamidopenta-2,4-dienoate;methyl 2-acetamidoprop-2-enoate |
|---|---|
| PubChem CID | 143525335 |
| Molecular Formula | C15H24N2O6 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | methane;methyl (2Z)-2-acetamidopenta-2,4-dienoate;methyl 2-acetamidoprop-2-enoate |
| SMILES | C.C=C(NC(C)=O)C(=O)OC.C=C/C=C(\NC(C)=O)C(=O)OC |
| InChI | InChI=1S/C8H11NO3.C6H9NO3.CH4/c1-4-5-7(8(11)12-3)9-6(2)10;1-4(6(9)10-3)7-5(2)8;/h4-5H,1H2,2-3H3,(H,9,10);1H2,2-3H3,(H,7,8);1H4/b7-5-;; |
| InChIKey | XZFQBWZEUJFMQJ-MWKZNRQPSA-N |
| XLogP | 0.81 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|