C10H14BrNO — CID 145058576
N-[(3Z)-3-(1-bromoethenyl)hexa-3,5-dienyl]acetamide (PubChem CID 145058576) has the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. Its IUPAC name is N-[(3Z)-3-(1-bromoethenyl)hexa-3,5-dienyl]acetamide.
| Compound Name | N-[(3Z)-3-(1-bromoethenyl)hexa-3,5-dienyl]acetamide |
|---|---|
| PubChem CID | 145058576 |
| Molecular Formula | C10H14BrNO |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | N-[(3Z)-3-(1-bromoethenyl)hexa-3,5-dienyl]acetamide |
| SMILES | C=C/C=C(/CCNC(C)=O)C(=C)Br |
| InChI | InChI=1S/C10H14BrNO/c1-4-5-10(8(2)11)6-7-12-9(3)13/h4-5H,1-2,6-7H2,3H3,(H,12,13)/b10-5- |
| InChIKey | OWDDROWIKYOQFB-YHYXMXQVSA-N |
| XLogP | 2.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|