C16H25NO2 — CID 144874537
N-[6-[(2E)-2-ethenylpenta-2,4-dienoxy]hept-6-enyl]acetamide (PubChem CID 144874537) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[6-[(2E)-2-ethenylpenta-2,4-dienoxy]hept-6-enyl]acetamide.
| Compound Name | N-[6-[(2E)-2-ethenylpenta-2,4-dienoxy]hept-6-enyl]acetamide |
|---|---|
| PubChem CID | 144874537 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-[6-[(2E)-2-ethenylpenta-2,4-dienoxy]hept-6-enyl]acetamide |
| SMILES | C=C/C=C(\C=C)COC(=C)CCCCCNC(C)=O |
| InChI | InChI=1S/C16H25NO2/c1-5-10-16(6-2)13-19-14(3)11-8-7-9-12-17-15(4)18/h5-6,10H,1-3,7-9,11-13H2,4H3,(H,17,18)/b16-10+ |
| InChIKey | OIWJGBFAZQTGPN-MHWRWJLKSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|