About formic acid;methyl 7-acetamidoheptanoate
formic acid;methyl 7-acetamidoheptanoate (PubChem CID 145029854) has the molecular formula C11H21NO5
and a molecular weight of 247.29 g/mol. Its IUPAC name is formic acid;methyl 7-acetamidoheptanoate.
Molecular Properties
| Compound Name | formic acid;methyl 7-acetamidoheptanoate |
| PubChem CID | 145029854 |
| Molecular Formula | C11H21NO5 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | formic acid;methyl 7-acetamidoheptanoate |
| SMILES | COC(=O)CCCCCCNC(C)=O.O=CO |
| InChI | InChI=1S/C10H19NO3.CH2O2/c1-9(12)11-8-6-4-3-5-7-10(13)14-2;2-1-3/h3-8H2,1-2H3,(H,11,12);1H,(H,2,3) |
| InChIKey | YGPCHIPVBXVRHT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formic acid;methyl 7-acetamidoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;methyl 7-acetamidoheptanoate?
The IUPAC name of formic acid;methyl 7-acetamidoheptanoate (CID 145029854) is formic acid;methyl 7-acetamidoheptanoate.
What is the SMILES notation for formic acid;methyl 7-acetamidoheptanoate?
The canonical SMILES for formic acid;methyl 7-acetamidoheptanoate is COC(=O)CCCCCCNC(C)=O.O=CO.
What is the InChIKey of formic acid;methyl 7-acetamidoheptanoate?
The InChIKey is YGPCHIPVBXVRHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3.CH2O2/c1-9(12)11-8-6-4-3-5-7-10(13)14-2;2-1-3/h3-8H2,1-2H3,(H,11,12);1H,(H,2,3).
What are the key properties of formic acid;methyl 7-acetamidoheptanoate?
formic acid;methyl 7-acetamidoheptanoate has a molecular weight of 247.29 g/mol, XLogP of 0.95, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;methyl 7-acetamidoheptanoate is sourced from PubChem (CID 145029854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).