About phosphono 6-acetamidohexanoate
phosphono 6-acetamidohexanoate (PubChem CID 87087647) has the molecular formula C8H16NO6P
and a molecular weight of 253.19 g/mol. Its IUPAC name is phosphono 6-acetamidohexanoate.
Molecular Properties
| Compound Name | phosphono 6-acetamidohexanoate |
| PubChem CID | 87087647 |
| Molecular Formula | C8H16NO6P |
| Molecular Weight | 253.19 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | phosphono 6-acetamidohexanoate |
| SMILES | CC(=O)NCCCCCC(=O)OP(=O)(O)O |
| InChI | InChI=1S/C8H16NO6P/c1-7(10)9-6-4-2-3-5-8(11)15-16(12,13)14/h2-6H2,1H3,(H,9,10)(H2,12,13,14) |
| InChIKey | OTAIDQCHVKFDQZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.19 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphono 6-acetamidohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphono 6-acetamidohexanoate?
The IUPAC name of phosphono 6-acetamidohexanoate (CID 87087647) is phosphono 6-acetamidohexanoate.
What is the SMILES notation for phosphono 6-acetamidohexanoate?
The canonical SMILES for phosphono 6-acetamidohexanoate is CC(=O)NCCCCCC(=O)OP(=O)(O)O.
What is the InChIKey of phosphono 6-acetamidohexanoate?
The InChIKey is OTAIDQCHVKFDQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16NO6P/c1-7(10)9-6-4-2-3-5-8(11)15-16(12,13)14/h2-6H2,1H3,(H,9,10)(H2,12,13,14).
What are the key properties of phosphono 6-acetamidohexanoate?
phosphono 6-acetamidohexanoate has a molecular weight of 253.19 g/mol, XLogP of 0.32, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phosphono 6-acetamidohexanoate is sourced from PubChem (CID 87087647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).