C11H18N2O4S — CID 134297811
S-[2-(prop-2-enoxycarbonylamino)ethyl] 3-acetamidopropanethioate (PubChem CID 134297811) has the molecular formula C11H18N2O4S and a molecular weight of 274.34 g/mol. Its IUPAC name is S-[2-(prop-2-enoxycarbonylamino)ethyl] 3-acetamidopropanethioate.
| Compound Name | S-[2-(prop-2-enoxycarbonylamino)ethyl] 3-acetamidopropanethioate |
|---|---|
| PubChem CID | 134297811 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | S-[2-(prop-2-enoxycarbonylamino)ethyl] 3-acetamidopropanethioate |
| SMILES | C=CCOC(=O)NCCSC(=O)CCNC(C)=O |
| InChI | InChI=1S/C11H18N2O4S/c1-3-7-17-11(16)13-6-8-18-10(15)4-5-12-9(2)14/h3H,1,4-8H2,2H3,(H,12,14)(H,13,16) |
| InChIKey | IXXQFQAVEPUUNL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|