About S-(2-acetamidoethyl) 8-aminooctanethioate
S-(2-acetamidoethyl) 8-aminooctanethioate (PubChem CID 155119307) has the molecular formula C12H24N2O2S
and a molecular weight of 260.40 g/mol. Its IUPAC name is S-(2-acetamidoethyl) 8-aminooctanethioate.
Molecular Properties
| Compound Name | S-(2-acetamidoethyl) 8-aminooctanethioate |
| PubChem CID | 155119307 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | S-(2-acetamidoethyl) 8-aminooctanethioate |
| SMILES | CC(=O)NCCSC(=O)CCCCCCCN |
| InChI | InChI=1S/C12H24N2O2S/c1-11(15)14-9-10-17-12(16)7-5-3-2-4-6-8-13/h2-10,13H2,1H3,(H,14,15) |
| InChIKey | SICOKBIVQVNYTQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetamidoethyl) 8-aminooctanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetamidoethyl) 8-aminooctanethioate?
The IUPAC name of S-(2-acetamidoethyl) 8-aminooctanethioate (CID 155119307) is S-(2-acetamidoethyl) 8-aminooctanethioate.
What is the SMILES notation for S-(2-acetamidoethyl) 8-aminooctanethioate?
The canonical SMILES for S-(2-acetamidoethyl) 8-aminooctanethioate is CC(=O)NCCSC(=O)CCCCCCCN.
What is the InChIKey of S-(2-acetamidoethyl) 8-aminooctanethioate?
The InChIKey is SICOKBIVQVNYTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2S/c1-11(15)14-9-10-17-12(16)7-5-3-2-4-6-8-13/h2-10,13H2,1H3,(H,14,15).
What are the key properties of S-(2-acetamidoethyl) 8-aminooctanethioate?
S-(2-acetamidoethyl) 8-aminooctanethioate has a molecular weight of 260.40 g/mol, XLogP of 1.68, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetamidoethyl) 8-aminooctanethioate is sourced from PubChem (CID 155119307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).