C6H17N3O — CID 142425997
N-(2-aminoethyl)acetamide;ethanamine (PubChem CID 142425997) has the molecular formula C6H17N3O and a molecular weight of 147.22 g/mol. Its IUPAC name is N-(2-aminoethyl)acetamide;ethanamine.
| Compound Name | N-(2-aminoethyl)acetamide;ethanamine |
|---|---|
| PubChem CID | 142425997 |
| Molecular Formula | C6H17N3O |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.14 |
| IUPAC Name | N-(2-aminoethyl)acetamide;ethanamine |
| SMILES | CC(=O)NCCN.CCN |
| InChI | InChI=1S/C4H10N2O.C2H7N/c1-4(7)6-3-2-5;1-2-3/h2-3,5H2,1H3,(H,6,7);2-3H2,1H3 |
| InChIKey | GFIGXVZUJUTMRJ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |