C12H29N3O — CID 142425870
N-(2-aminoethyl)acetamide;1-cyclopropylpropan-1-amine;ethane (PubChem CID 142425870) has the molecular formula C12H29N3O and a molecular weight of 231.38 g/mol. Its IUPAC name is N-(2-aminoethyl)acetamide;1-cyclopropylpropan-1-amine;ethane.
| Compound Name | N-(2-aminoethyl)acetamide;1-cyclopropylpropan-1-amine;ethane |
|---|---|
| PubChem CID | 142425870 |
| Molecular Formula | C12H29N3O |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.23 |
| IUPAC Name | N-(2-aminoethyl)acetamide;1-cyclopropylpropan-1-amine;ethane |
| SMILES | CC.CC(=O)NCCN.CCC(N)C1CC1 |
| InChI | InChI=1S/C6H13N.C4H10N2O.C2H6/c1-2-6(7)5-3-4-5;1-4(7)6-3-2-5;1-2/h5-6H,2-4,7H2,1H3;2-3,5H2,1H3,(H,6,7);1-2H3 |
| InChIKey | XBQKSDFVJANDOY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |