C8H21N3O3S — CID 161235509
N-(2-aminoethyl)methanesulfonamide;N-propylacetamide (PubChem CID 161235509) has the molecular formula C8H21N3O3S and a molecular weight of 239.34 g/mol. Its IUPAC name is N-(2-aminoethyl)methanesulfonamide;N-propylacetamide.
| Compound Name | N-(2-aminoethyl)methanesulfonamide;N-propylacetamide |
|---|---|
| PubChem CID | 161235509 |
| Molecular Formula | C8H21N3O3S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-(2-aminoethyl)methanesulfonamide;N-propylacetamide |
| SMILES | CCCNC(C)=O.CS(=O)(=O)NCCN |
| InChI | InChI=1S/C5H11NO.C3H10N2O2S/c1-3-4-6-5(2)7;1-8(6,7)5-3-2-4/h3-4H2,1-2H3,(H,6,7);5H,2-4H2,1H3 |
| InChIKey | UZHULXQPIZDSNP-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |