About N-methylacetamide;N-propylacetamide
N-methylacetamide;N-propylacetamide (PubChem CID 160752156) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is N-methylacetamide;N-propylacetamide.
Molecular Properties
| Compound Name | N-methylacetamide;N-propylacetamide |
| PubChem CID | 160752156 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | N-methylacetamide;N-propylacetamide |
| SMILES | CCCNC(C)=O.CNC(C)=O |
| InChI | InChI=1S/C5H11NO.C3H7NO/c1-3-4-6-5(2)7;1-3(5)4-2/h3-4H2,1-2H3,(H,6,7);1-2H3,(H,4,5) |
| InChIKey | RWYUUUWEIQOXBU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methylacetamide;N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylacetamide;N-propylacetamide?
The IUPAC name of N-methylacetamide;N-propylacetamide (CID 160752156) is N-methylacetamide;N-propylacetamide.
What is the SMILES notation for N-methylacetamide;N-propylacetamide?
The canonical SMILES for N-methylacetamide;N-propylacetamide is CCCNC(C)=O.CNC(C)=O.
What is the InChIKey of N-methylacetamide;N-propylacetamide?
The InChIKey is RWYUUUWEIQOXBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C3H7NO/c1-3-4-6-5(2)7;1-3(5)4-2/h3-4H2,1-2H3,(H,6,7);1-2H3,(H,4,5).
What are the key properties of N-methylacetamide;N-propylacetamide?
N-methylacetamide;N-propylacetamide has a molecular weight of 174.24 g/mol, XLogP of 0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylacetamide;N-propylacetamide is sourced from PubChem (CID 160752156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).