About S-(2-acetamidoethyl) 5-oxohexanethioate
S-(2-acetamidoethyl) 5-oxohexanethioate (PubChem CID 125498006) has the molecular formula C10H17NO3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is S-(2-acetamidoethyl) 5-oxohexanethioate.
Molecular Properties
| Compound Name | S-(2-acetamidoethyl) 5-oxohexanethioate |
| PubChem CID | 125498006 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | S-(2-acetamidoethyl) 5-oxohexanethioate |
| SMILES | CC(=O)CCCC(=O)SCCNC(C)=O |
| InChI | InChI=1S/C10H17NO3S/c1-8(12)4-3-5-10(14)15-7-6-11-9(2)13/h3-7H2,1-2H3,(H,11,13) |
| InChIKey | RWAPNVBJRVEMPX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetamidoethyl) 5-oxohexanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetamidoethyl) 5-oxohexanethioate?
The IUPAC name of S-(2-acetamidoethyl) 5-oxohexanethioate (CID 125498006) is S-(2-acetamidoethyl) 5-oxohexanethioate.
What is the SMILES notation for S-(2-acetamidoethyl) 5-oxohexanethioate?
The canonical SMILES for S-(2-acetamidoethyl) 5-oxohexanethioate is CC(=O)CCCC(=O)SCCNC(C)=O.
What is the InChIKey of S-(2-acetamidoethyl) 5-oxohexanethioate?
The InChIKey is RWAPNVBJRVEMPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3S/c1-8(12)4-3-5-10(14)15-7-6-11-9(2)13/h3-7H2,1-2H3,(H,11,13).
What are the key properties of S-(2-acetamidoethyl) 5-oxohexanethioate?
S-(2-acetamidoethyl) 5-oxohexanethioate has a molecular weight of 231.32 g/mol, XLogP of 1.14, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetamidoethyl) 5-oxohexanethioate is sourced from PubChem (CID 125498006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).