C12H21NO3S — CID 56603558
S-(2-acetamidoethyl) (E,3S)-3-hydroxyoct-4-enethioate (PubChem CID 56603558) has the molecular formula C12H21NO3S and a molecular weight of 259.37 g/mol. Its IUPAC name is S-(2-acetamidoethyl) (E,3S)-3-hydroxyoct-4-enethioate.
| Compound Name | S-(2-acetamidoethyl) (E,3S)-3-hydroxyoct-4-enethioate |
|---|---|
| PubChem CID | 56603558 |
| Molecular Formula | C12H21NO3S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | S-(2-acetamidoethyl) (E,3S)-3-hydroxyoct-4-enethioate |
| SMILES | CCC/C=C/[C@@H](O)CC(=O)SCCNC(C)=O |
| InChI | InChI=1S/C12H21NO3S/c1-3-4-5-6-11(15)9-12(16)17-8-7-13-10(2)14/h5-6,11,15H,3-4,7-9H2,1-2H3,(H,13,14)/b6-5+/t11-/m1/s1 |
| InChIKey | UPJCIKPLXRPRKI-MVIFTORASA-N |
| XLogP | 1.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|