C16H27NO5S — CID 10569821
S-(2-acetamidoethyl) 2,2,3,3-tetradeuterio-9-hydroxy-4,5-dioxododecanethioate (PubChem CID 10569821) has the molecular formula C16H27NO5S and a molecular weight of 349.49 g/mol. Its IUPAC name is S-(2-acetamidoethyl) 2,2,3,3-tetradeuterio-9-hydroxy-4,5-dioxododecanethioate.
| Compound Name | S-(2-acetamidoethyl) 2,2,3,3-tetradeuterio-9-hydroxy-4,5-dioxododecanethioate |
|---|---|
| PubChem CID | 10569821 |
| Molecular Formula | C16H27NO5S |
| Molecular Weight | 349.49 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | S-(2-acetamidoethyl) 2,2,3,3-tetradeuterio-9-hydroxy-4,5-dioxododecanethioate |
| SMILES | [2H]C([2H])(C(=O)SCCNC(C)=O)C([2H])([2H])C(=O)C(=O)CCCC(O)CCC |
| InChI | InChI=1S/C16H27NO5S/c1-3-5-13(19)6-4-7-14(20)15(21)8-9-16(22)23-11-10-17-12(2)18/h13,19H,3-11H2,1-2H3,(H,17,18)/i8D2,9D2 |
| InChIKey | ZSNKGGQKJFNWJP-LZMSFWOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|