About S-(2-acetamidoethyl) (213C)ethanethioate
S-(2-acetamidoethyl) (213C)ethanethioate (PubChem CID 46188004) has the molecular formula C6H11NO2S
and a molecular weight of 162.22 g/mol. Its IUPAC name is S-(2-acetamidoethyl) (213C)ethanethioate.
Molecular Properties
| Compound Name | S-(2-acetamidoethyl) (213C)ethanethioate |
| PubChem CID | 46188004 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | S-(2-acetamidoethyl) (213C)ethanethioate |
| SMILES | CC(=O)NCCSC([13CH3])=O |
| InChI | InChI=1S/C6H11NO2S/c1-5(8)7-3-4-10-6(2)9/h3-4H2,1-2H3,(H,7,8)/i2+1 |
| InChIKey | UZLRPNHVKXCOHS-VQEHIDDOSA-N |
| XLogP | 0.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-acetamidoethyl) (213C)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-acetamidoethyl) (213C)ethanethioate?
The IUPAC name of S-(2-acetamidoethyl) (213C)ethanethioate (CID 46188004) is S-(2-acetamidoethyl) (213C)ethanethioate.
What is the SMILES notation for S-(2-acetamidoethyl) (213C)ethanethioate?
The canonical SMILES for S-(2-acetamidoethyl) (213C)ethanethioate is CC(=O)NCCSC([13CH3])=O.
What is the InChIKey of S-(2-acetamidoethyl) (213C)ethanethioate?
The InChIKey is UZLRPNHVKXCOHS-VQEHIDDOSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-5(8)7-3-4-10-6(2)9/h3-4H2,1-2H3,(H,7,8)/i2+1.
What are the key properties of S-(2-acetamidoethyl) (213C)ethanethioate?
S-(2-acetamidoethyl) (213C)ethanethioate has a molecular weight of 162.22 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-acetamidoethyl) (213C)ethanethioate is sourced from PubChem (CID 46188004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).