C9H16N2O3S2 — CID 22253947
S-[2-[(2-acetamido-3-sulfanylpropanoyl)amino]ethyl] ethanethioate (PubChem CID 22253947) has the molecular formula C9H16N2O3S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is S-[2-[(2-acetamido-3-sulfanylpropanoyl)amino]ethyl] ethanethioate.
| Compound Name | S-[2-[(2-acetamido-3-sulfanylpropanoyl)amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 22253947 |
| Molecular Formula | C9H16N2O3S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | S-[2-[(2-acetamido-3-sulfanylpropanoyl)amino]ethyl] ethanethioate |
| SMILES | CC(=O)NC(CS)C(=O)NCCSC(C)=O |
| InChI | InChI=1S/C9H16N2O3S2/c1-6(12)11-8(5-15)9(14)10-3-4-16-7(2)13/h8,15H,3-5H2,1-2H3,(H,10,14)(H,11,12) |
| InChIKey | PCFWUYJHCYCQKP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|