C12H24N2O2S — CID 114102273
2-acetamido-3-sulfanyl-N-(2,2,3-trimethylbutyl)propanamide (PubChem CID 114102273) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 2-acetamido-3-sulfanyl-N-(2,2,3-trimethylbutyl)propanamide.
| Compound Name | 2-acetamido-3-sulfanyl-N-(2,2,3-trimethylbutyl)propanamide |
|---|---|
| PubChem CID | 114102273 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-acetamido-3-sulfanyl-N-(2,2,3-trimethylbutyl)propanamide |
| SMILES | CC(=O)NC(CS)C(=O)NCC(C)(C)C(C)C |
| InChI | InChI=1S/C12H24N2O2S/c1-8(2)12(4,5)7-13-11(16)10(6-17)14-9(3)15/h8,10,17H,6-7H2,1-5H3,(H,13,16)(H,14,15) |
| InChIKey | ABBHYOPCXSXIHQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|