C10H20N2O3S — CID 107769892
2-acetamido-N-(4-hydroxy-3-methylbutan-2-yl)-3-sulfanylpropanamide (PubChem CID 107769892) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-acetamido-N-(4-hydroxy-3-methylbutan-2-yl)-3-sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(4-hydroxy-3-methylbutan-2-yl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107769892 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-acetamido-N-(4-hydroxy-3-methylbutan-2-yl)-3-sulfanylpropanamide |
| SMILES | CC(=O)NC(CS)C(=O)NC(C)C(C)CO |
| InChI | InChI=1S/C10H20N2O3S/c1-6(4-13)7(2)11-10(15)9(5-16)12-8(3)14/h6-7,9,13,16H,4-5H2,1-3H3,(H,11,15)(H,12,14) |
| InChIKey | FIJRCAHVURIQHO-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|