C5H9NO2S2 — CID 89034608
2-acetamido-3-sulfanylpropanethioic S-acid (PubChem CID 89034608) has the molecular formula C5H9NO2S2 and a molecular weight of 179.27 g/mol. Its IUPAC name is 2-acetamido-3-sulfanylpropanethioic S-acid.
| Compound Name | 2-acetamido-3-sulfanylpropanethioic S-acid |
|---|---|
| PubChem CID | 89034608 |
| Molecular Formula | C5H9NO2S2 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | 2-acetamido-3-sulfanylpropanethioic S-acid |
| SMILES | CC(=O)NC(CS)C(=O)S |
| InChI | InChI=1S/C5H9NO2S2/c1-3(7)6-4(2-9)5(8)10/h4,9H,2H2,1H3,(H,6,7)(H,8,10) |
| InChIKey | JSLXERBWZOFLLS-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|