C5H10NOPS2 — CID 89034866
N-(1-phosphanyl-3-sulfanyl-1-sulfanylidenepropan-2-yl)acetamide (PubChem CID 89034866) has the molecular formula C5H10NOPS2 and a molecular weight of 195.25 g/mol. Its IUPAC name is N-(1-phosphanyl-3-sulfanyl-1-sulfanylidenepropan-2-yl)acetamide.
| Compound Name | N-(1-phosphanyl-3-sulfanyl-1-sulfanylidenepropan-2-yl)acetamide |
|---|---|
| PubChem CID | 89034866 |
| Molecular Formula | C5H10NOPS2 |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 194.99 |
| IUPAC Name | N-(1-phosphanyl-3-sulfanyl-1-sulfanylidenepropan-2-yl)acetamide |
| SMILES | CC(=O)NC(CS)C(P)=S |
| InChI | InChI=1S/C5H10NOPS2/c1-3(7)6-4(2-9)5(8)10/h4,9H,2,8H2,1H3,(H,6,7) |
| InChIKey | FZBLWBYYAWEUJW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|