C12H23NO6S — CID 107770080
2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-acetamido-3-sulfanylpropanoate (PubChem CID 107770080) has the molecular formula C12H23NO6S and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-acetamido-3-sulfanylpropanoate.
| Compound Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 107770080 |
| Molecular Formula | C12H23NO6S |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-[2-(2-methoxyethoxy)ethoxy]ethyl 2-acetamido-3-sulfanylpropanoate |
| SMILES | COCCOCCOCCOC(=O)C(CS)NC(C)=O |
| InChI | InChI=1S/C12H23NO6S/c1-10(14)13-11(9-20)12(15)19-8-7-18-6-5-17-4-3-16-2/h11,20H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | FDOUFLNWDPIZRD-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|