C10H19NO3S — CID 170446459
[(2R)-3-methylbutan-2-yl] (2R)-2-acetamido-3-sulfanylpropanoate (PubChem CID 170446459) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is [(2R)-3-methylbutan-2-yl] (2R)-2-acetamido-3-sulfanylpropanoate.
| Compound Name | [(2R)-3-methylbutan-2-yl] (2R)-2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 170446459 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | [(2R)-3-methylbutan-2-yl] (2R)-2-acetamido-3-sulfanylpropanoate |
| SMILES | CC(=O)N[C@@H](CS)C(=O)O[C@H](C)C(C)C |
| InChI | InChI=1S/C10H19NO3S/c1-6(2)7(3)14-10(13)9(5-15)11-8(4)12/h6-7,9,15H,5H2,1-4H3,(H,11,12)/t7-,9+/m1/s1 |
| InChIKey | GQRBJSDDZUNTOW-APPZFPTMSA-N |
| XLogP | 1.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|