C8H17NO2S — CID 107774194
3-methylbutan-2-yl (2R)-2-amino-3-sulfanylpropanoate (PubChem CID 107774194) has the molecular formula C8H17NO2S and a molecular weight of 191.30 g/mol. Its IUPAC name is 3-methylbutan-2-yl (2R)-2-amino-3-sulfanylpropanoate.
| Compound Name | 3-methylbutan-2-yl (2R)-2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 107774194 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 3-methylbutan-2-yl (2R)-2-amino-3-sulfanylpropanoate |
| SMILES | CC(C)C(C)OC(=O)[C@@H](N)CS |
| InChI | InChI=1S/C8H17NO2S/c1-5(2)6(3)11-8(10)7(9)4-12/h5-7,12H,4,9H2,1-3H3/t6?,7-/m0/s1 |
| InChIKey | ATJKNEVXMYCTND-MLWJPKLSSA-N |
| XLogP | 0.83 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|