About [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride
[(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride (PubChem CID 174802204) has the molecular formula C7H13ClN2O5S2
and a molecular weight of 304.78 g/mol. Its IUPAC name is [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride |
| PubChem CID | 174802204 |
| Molecular Formula | C7H13ClN2O5S2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride |
| SMILES | Cl.N[C@@H](CS)C(=O)OC(=O)OC(=O)[C@@H](N)CS |
| InChI | InChI=1S/C7H12N2O5S2.ClH/c8-3(1-15)5(10)13-7(12)14-6(11)4(9)2-16;/h3-4,15-16H,1-2,8-9H2;1H/t3-,4-;/m0./s1 |
| InChIKey | REWAYKWWAWQSOD-MMALYQPHSA-N |
| XLogP | -0.87 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride?
The IUPAC name of [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride (CID 174802204) is [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride.
What is the SMILES notation for [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride?
The canonical SMILES for [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride is Cl.N[C@@H](CS)C(=O)OC(=O)OC(=O)[C@@H](N)CS.
What is the InChIKey of [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride?
The InChIKey is REWAYKWWAWQSOD-MMALYQPHSA-N. The full InChI is InChI=1S/C7H12N2O5S2.ClH/c8-3(1-15)5(10)13-7(12)14-6(11)4(9)2-16;/h3-4,15-16H,1-2,8-9H2;1H/t3-,4-;/m0./s1.
What are the key properties of [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride?
[(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride has a molecular weight of 304.78 g/mol, XLogP of -0.87, 4 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-amino-3-sulfanylpropanoyl]oxycarbonyl (2R)-2-amino-3-sulfanylpropanoate;hydrochloride is sourced from PubChem (CID 174802204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).