C3H7NO3S — CID 91512911
(2R)-2-amino-3-sulfanylpropaneperoxoic acid (PubChem CID 91512911) has the molecular formula C3H7NO3S and a molecular weight of 137.16 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropaneperoxoic acid.
| Compound Name | (2R)-2-amino-3-sulfanylpropaneperoxoic acid |
|---|---|
| PubChem CID | 91512911 |
| Molecular Formula | C3H7NO3S |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.01 |
| IUPAC Name | (2R)-2-amino-3-sulfanylpropaneperoxoic acid |
| SMILES | N[C@@H](CS)C(=O)OO |
| InChI | InChI=1S/C3H7NO3S/c4-2(1-8)3(5)7-6/h2,6,8H,1,4H2/t2-/m0/s1 |
| InChIKey | LYODBTWWQKGPJK-REOHCLBHSA-N |
| XLogP | -0.74 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|