C6H12N2O4S — CID 87672799
(2R)-2-amino-3-[(2R)-2-amino-3-sulfanylpropanoyl]oxypropanoic acid (PubChem CID 87672799) has the molecular formula C6H12N2O4S and a molecular weight of 208.24 g/mol. Its IUPAC name is (2R)-2-amino-3-[(2R)-2-amino-3-sulfanylpropanoyl]oxypropanoic acid.
| Compound Name | (2R)-2-amino-3-[(2R)-2-amino-3-sulfanylpropanoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 87672799 |
| Molecular Formula | C6H12N2O4S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (2R)-2-amino-3-[(2R)-2-amino-3-sulfanylpropanoyl]oxypropanoic acid |
| SMILES | N[C@H](COC(=O)[C@@H](N)CS)C(=O)O |
| InChI | InChI=1S/C6H12N2O4S/c7-3(5(9)10)1-12-6(11)4(8)2-13/h3-4,13H,1-2,7-8H2,(H,9,10)/t3-,4+/m1/s1 |
| InChIKey | ALXMABDMBOVZMM-DMTCNVIQSA-N |
| XLogP | -1.80 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|