C7H12N2O5S — CID 57013589
(2S)-2-amino-4-[(2R)-2-amino-3-sulfanylpropanoyl]oxy-4-oxobutanoic acid (PubChem CID 57013589) has the molecular formula C7H12N2O5S and a molecular weight of 236.25 g/mol. Its IUPAC name is (2S)-2-amino-4-[(2R)-2-amino-3-sulfanylpropanoyl]oxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-amino-4-[(2R)-2-amino-3-sulfanylpropanoyl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57013589 |
| Molecular Formula | C7H12N2O5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (2S)-2-amino-4-[(2R)-2-amino-3-sulfanylpropanoyl]oxy-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)OC(=O)[C@@H](N)CS)C(=O)O |
| InChI | InChI=1S/C7H12N2O5S/c8-3(6(11)12)1-5(10)14-7(13)4(9)2-15/h3-4,15H,1-2,8-9H2,(H,11,12)/t3-,4-/m0/s1 |
| InChIKey | DEHNABZVKZFKBW-IMJSIDKUSA-N |
| XLogP | -1.88 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|