C10H16N2O7S2 — CID 88715639
bis[(2S)-2-amino-3-sulfanylpropanoyl] 2-hydroxybutanedioate (PubChem CID 88715639) has the molecular formula C10H16N2O7S2 and a molecular weight of 340.38 g/mol. Its IUPAC name is bis[(2S)-2-amino-3-sulfanylpropanoyl] 2-hydroxybutanedioate.
| Compound Name | bis[(2S)-2-amino-3-sulfanylpropanoyl] 2-hydroxybutanedioate |
|---|---|
| PubChem CID | 88715639 |
| Molecular Formula | C10H16N2O7S2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | bis[(2S)-2-amino-3-sulfanylpropanoyl] 2-hydroxybutanedioate |
| SMILES | N[C@H](CS)C(=O)OC(=O)CC(O)C(=O)OC(=O)[C@H](N)CS |
| InChI | InChI=1S/C10H16N2O7S2/c11-4(2-20)8(15)18-7(14)1-6(13)10(17)19-9(16)5(12)3-21/h4-6,13,20-21H,1-3,11-12H2/t4-,5-,6?/m1/s1 |
| InChIKey | HSIYQGLPRZJHJZ-QYRBDRAASA-N |
| XLogP | -2.61 |
| TPSA | 159.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|