C8H14N2O5S — CID 76508278
4-amino-5-(2-amino-3-sulfanylpropanoyl)oxy-5-oxopentanoic acid (PubChem CID 76508278) has the molecular formula C8H14N2O5S and a molecular weight of 250.28 g/mol. Its IUPAC name is 4-amino-5-(2-amino-3-sulfanylpropanoyl)oxy-5-oxopentanoic acid.
| Compound Name | 4-amino-5-(2-amino-3-sulfanylpropanoyl)oxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 76508278 |
| Molecular Formula | C8H14N2O5S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-amino-5-(2-amino-3-sulfanylpropanoyl)oxy-5-oxopentanoic acid |
| SMILES | NC(CS)C(=O)OC(=O)C(N)CCC(=O)O |
| InChI | InChI=1S/C8H14N2O5S/c9-4(1-2-6(11)12)7(13)15-8(14)5(10)3-16/h4-5,16H,1-3,9-10H2,(H,11,12) |
| InChIKey | ANDRTDSFNRRDHQ-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|