About bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate
bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate (PubChem CID 57308411) has the molecular formula C10H17N3O6S2
and a molecular weight of 339.40 g/mol. Its IUPAC name is bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate.
Molecular Properties
| Compound Name | bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate |
| PubChem CID | 57308411 |
| Molecular Formula | C10H17N3O6S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate |
| SMILES | N[C@@H](CS)C(=O)OC(=O)C[C@H](N)C(=O)OC(=O)[C@@H](N)CS |
| InChI | InChI=1S/C10H17N3O6S2/c11-4(8(15)19-10(17)6(13)3-21)1-7(14)18-9(16)5(12)2-20/h4-6,20-21H,1-3,11-13H2/t4-,5-,6-/m0/s1 |
| InChIKey | AJSKUHPXWQLTON-ZLUOBGJFSA-N |
| XLogP | -2.64 |
| TPSA | 164.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate?
The IUPAC name of bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate (CID 57308411) is bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate.
What is the SMILES notation for bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate?
The canonical SMILES for bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate is N[C@@H](CS)C(=O)OC(=O)C[C@H](N)C(=O)OC(=O)[C@@H](N)CS.
What is the InChIKey of bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate?
The InChIKey is AJSKUHPXWQLTON-ZLUOBGJFSA-N. The full InChI is InChI=1S/C10H17N3O6S2/c11-4(8(15)19-10(17)6(13)3-21)1-7(14)18-9(16)5(12)2-20/h4-6,20-21H,1-3,11-13H2/t4-,5-,6-/m0/s1.
What are the key properties of bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate?
bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate has a molecular weight of 339.40 g/mol, XLogP of -2.64, 7 rotatable bonds, 5 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2R)-2-amino-3-sulfanylpropanoyl] (2S)-2-aminobutanedioate is sourced from PubChem (CID 57308411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).