C10H11NO10 — CID 87196678
3-[3-amino-4-(2-carboxyacetyl)oxy-4-oxobutanoyl]oxy-3-oxopropanoic acid (PubChem CID 87196678) has the molecular formula C10H11NO10 and a molecular weight of 305.20 g/mol. Its IUPAC name is 3-[3-amino-4-(2-carboxyacetyl)oxy-4-oxobutanoyl]oxy-3-oxopropanoic acid.
| Compound Name | 3-[3-amino-4-(2-carboxyacetyl)oxy-4-oxobutanoyl]oxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 87196678 |
| Molecular Formula | C10H11NO10 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-[3-amino-4-(2-carboxyacetyl)oxy-4-oxobutanoyl]oxy-3-oxopropanoic acid |
| SMILES | NC(CC(=O)OC(=O)CC(=O)O)C(=O)OC(=O)CC(=O)O |
| InChI | InChI=1S/C10H11NO10/c11-4(10(19)21-9(18)3-6(14)15)1-7(16)20-8(17)2-5(12)13/h4H,1-3,11H2,(H,12,13)(H,14,15) |
| InChIKey | BTUIJDGRVXSBDB-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 187.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|