C12H15NO12 — CID 174613181
4-[(3S)-3-amino-4-(3-carboxy-3-hydroxypropanoyl)oxy-4-oxobutanoyl]oxy-2-hydroxy-4-oxobutanoic acid (PubChem CID 174613181) has the molecular formula C12H15NO12 and a molecular weight of 365.25 g/mol. Its IUPAC name is 4-[(3S)-3-amino-4-(3-carboxy-3-hydroxypropanoyl)oxy-4-oxobutanoyl]oxy-2-hydroxy-4-oxobutanoic acid.
| Compound Name | 4-[(3S)-3-amino-4-(3-carboxy-3-hydroxypropanoyl)oxy-4-oxobutanoyl]oxy-2-hydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174613181 |
| Molecular Formula | C12H15NO12 |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 4-[(3S)-3-amino-4-(3-carboxy-3-hydroxypropanoyl)oxy-4-oxobutanoyl]oxy-2-hydroxy-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)OC(=O)CC(O)C(=O)O)C(=O)OC(=O)CC(O)C(=O)O |
| InChI | InChI=1S/C12H15NO12/c13-4(12(23)25-9(18)3-6(15)11(21)22)1-7(16)24-8(17)2-5(14)10(19)20/h4-6,14-15H,1-3,13H2,(H,19,20)(H,21,22)/t4-,5?,6?/m0/s1 |
| InChIKey | MCVWTQNYGBJFFQ-KXGSVCODSA-N |
| XLogP | -3.49 |
| TPSA | 227.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|