C12H14O11 — CID 87732233
4-[4-(3-carboxypropanoyloxy)-3-hydroxy-4-oxobutanoyl]oxy-4-oxobutanoic acid (PubChem CID 87732233) has the molecular formula C12H14O11 and a molecular weight of 334.23 g/mol. Its IUPAC name is 4-[4-(3-carboxypropanoyloxy)-3-hydroxy-4-oxobutanoyl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[4-(3-carboxypropanoyloxy)-3-hydroxy-4-oxobutanoyl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87732233 |
| Molecular Formula | C12H14O11 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4-[4-(3-carboxypropanoyloxy)-3-hydroxy-4-oxobutanoyl]oxy-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OC(=O)CC(O)C(=O)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H14O11/c13-6(12(21)23-10(19)4-2-8(16)17)5-11(20)22-9(18)3-1-7(14)15/h6,13H,1-5H2,(H,14,15)(H,16,17) |
| InChIKey | ZZGQFCDTVKYKOX-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 181.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|