About 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate
1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate (PubChem CID 174624038) has the molecular formula C12H14O10
and a molecular weight of 318.23 g/mol. Its IUPAC name is 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate.
Molecular Properties
| Compound Name | 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate |
| PubChem CID | 174624038 |
| Molecular Formula | C12H14O10 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate |
| SMILES | COC(=O)C(O)CC(=O)OC(=O)CCC(=O)OC(=O)C(C)=O |
| InChI | InChI=1S/C12H14O10/c1-6(13)11(18)22-9(16)4-3-8(15)21-10(17)5-7(14)12(19)20-2/h7,14H,3-5H2,1-2H3 |
| InChIKey | RAPOIJAUTRRWJW-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 150.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate?
The IUPAC name of 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate (CID 174624038) is 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate.
What is the SMILES notation for 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate?
The canonical SMILES for 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate is COC(=O)C(O)CC(=O)OC(=O)CCC(=O)OC(=O)C(C)=O.
What is the InChIKey of 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate?
The InChIKey is RAPOIJAUTRRWJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O10/c1-6(13)11(18)22-9(16)4-3-8(15)21-10(17)5-7(14)12(19)20-2/h7,14H,3-5H2,1-2H3.
What are the key properties of 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate?
1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate has a molecular weight of 318.23 g/mol, XLogP of -1.58, 7 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-methyl 4-O-[4-oxo-4-(2-oxopropanoyloxy)butanoyl] 2-hydroxybutanedioate is sourced from PubChem (CID 174624038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).