C10H14O7S2 — CID 90266289
bis(3-sulfanylpropanoyl) 2-hydroxybutanedioate (PubChem CID 90266289) has the molecular formula C10H14O7S2 and a molecular weight of 310.35 g/mol. Its IUPAC name is bis(3-sulfanylpropanoyl) 2-hydroxybutanedioate.
| Compound Name | bis(3-sulfanylpropanoyl) 2-hydroxybutanedioate |
|---|---|
| PubChem CID | 90266289 |
| Molecular Formula | C10H14O7S2 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.02 |
| IUPAC Name | bis(3-sulfanylpropanoyl) 2-hydroxybutanedioate |
| SMILES | O=C(CCS)OC(=O)CC(O)C(=O)OC(=O)CCS |
| InChI | InChI=1S/C10H14O7S2/c11-6(10(15)17-8(13)2-4-19)5-9(14)16-7(12)1-3-18/h6,11,18-19H,1-5H2 |
| InChIKey | BSTMGLPTSJGCQI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|