About 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate
3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate (PubChem CID 87390425) has the molecular formula C10H15NO5S2
and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate.
Molecular Properties
| Compound Name | 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate |
| PubChem CID | 87390425 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate |
| SMILES | [H]/N=C(/CCC(=O)OC(=O)CCS)OC(=O)CCS |
| InChI | InChI=1S/C10H15NO5S2/c11-7(15-9(13)3-5-17)1-2-8(12)16-10(14)4-6-18/h11,17-18H,1-6H2/b11-7- |
| InChIKey | QZQSJXICDJZRJB-XFFZJAGNSA-N |
| XLogP | 1.00 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate?
The IUPAC name of 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate (CID 87390425) is 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate.
What is the SMILES notation for 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate?
The canonical SMILES for 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate is [H]/N=C(/CCC(=O)OC(=O)CCS)OC(=O)CCS.
What is the InChIKey of 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate?
The InChIKey is QZQSJXICDJZRJB-XFFZJAGNSA-N. The full InChI is InChI=1S/C10H15NO5S2/c11-7(15-9(13)3-5-17)1-2-8(12)16-10(14)4-6-18/h11,17-18H,1-6H2/b11-7-.
What are the key properties of 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate?
3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate has a molecular weight of 293.37 g/mol, XLogP of 1.00, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-sulfanylpropanoyl 4-imino-4-(3-sulfanylpropanoyloxy)butanoate is sourced from PubChem (CID 87390425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).