About propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate
propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate (PubChem CID 88805997) has the molecular formula C10H20O4S2
and a molecular weight of 268.40 g/mol. Its IUPAC name is propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate |
| PubChem CID | 88805997 |
| Molecular Formula | C10H20O4S2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate |
| SMILES | CCC.O=C(CCS)OCOC(=O)CCS |
| InChI | InChI=1S/C7H12O4S2.C3H8/c8-6(1-3-12)10-5-11-7(9)2-4-13;1-3-2/h12-13H,1-5H2;3H2,1-2H3 |
| InChIKey | YMAXMPYPAXXOIT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate?
The IUPAC name of propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate (CID 88805997) is propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate.
What is the SMILES notation for propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate?
The canonical SMILES for propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate is CCC.O=C(CCS)OCOC(=O)CCS.
What is the InChIKey of propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate?
The InChIKey is YMAXMPYPAXXOIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O4S2.C3H8/c8-6(1-3-12)10-5-11-7(9)2-4-13;1-3-2/h12-13H,1-5H2;3H2,1-2H3.
What are the key properties of propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate?
propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate has a molecular weight of 268.40 g/mol, XLogP of 2.09, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propane;3-sulfanylpropanoyloxymethyl 3-sulfanylpropanoate is sourced from PubChem (CID 88805997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).