About azane;ethyl 3-sulfanylpropanoate;hydrate
azane;ethyl 3-sulfanylpropanoate;hydrate (PubChem CID 174908261) has the molecular formula C5H15NO3S
and a molecular weight of 169.25 g/mol. Its IUPAC name is azane;ethyl 3-sulfanylpropanoate;hydrate.
Molecular Properties
| Compound Name | azane;ethyl 3-sulfanylpropanoate;hydrate |
| PubChem CID | 174908261 |
| Molecular Formula | C5H15NO3S |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.08 |
| IUPAC Name | azane;ethyl 3-sulfanylpropanoate;hydrate |
| SMILES | CCOC(=O)CCS.N.O |
| InChI | InChI=1S/C5H10O2S.H3N.H2O/c1-2-7-5(6)3-4-8;;/h8H,2-4H2,1H3;1H3;1H2 |
| InChIKey | HWGCEPGUSUGQLJ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 92.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;ethyl 3-sulfanylpropanoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl 3-sulfanylpropanoate;hydrate?
The IUPAC name of azane;ethyl 3-sulfanylpropanoate;hydrate (CID 174908261) is azane;ethyl 3-sulfanylpropanoate;hydrate.
What is the SMILES notation for azane;ethyl 3-sulfanylpropanoate;hydrate?
The canonical SMILES for azane;ethyl 3-sulfanylpropanoate;hydrate is CCOC(=O)CCS.N.O.
What is the InChIKey of azane;ethyl 3-sulfanylpropanoate;hydrate?
The InChIKey is HWGCEPGUSUGQLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2S.H3N.H2O/c1-2-7-5(6)3-4-8;;/h8H,2-4H2,1H3;1H3;1H2.
What are the key properties of azane;ethyl 3-sulfanylpropanoate;hydrate?
azane;ethyl 3-sulfanylpropanoate;hydrate has a molecular weight of 169.25 g/mol, XLogP of 0.21, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl 3-sulfanylpropanoate;hydrate is sourced from PubChem (CID 174908261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).