About butane;methyl 3-sulfanylpropaneperoxoate
butane;methyl 3-sulfanylpropaneperoxoate (PubChem CID 87339576) has the molecular formula C8H18O3S
and a molecular weight of 194.30 g/mol. Its IUPAC name is butane;methyl 3-sulfanylpropaneperoxoate.
Molecular Properties
| Compound Name | butane;methyl 3-sulfanylpropaneperoxoate |
| PubChem CID | 87339576 |
| Molecular Formula | C8H18O3S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | butane;methyl 3-sulfanylpropaneperoxoate |
| SMILES | CCCC.COOC(=O)CCS |
| InChI | InChI=1S/C4H8O3S.C4H10/c1-6-7-4(5)2-3-8;1-3-4-2/h8H,2-3H2,1H3;3-4H2,1-2H3 |
| InChIKey | JGPVQEAWCFATTR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butane;methyl 3-sulfanylpropaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;methyl 3-sulfanylpropaneperoxoate?
The IUPAC name of butane;methyl 3-sulfanylpropaneperoxoate (CID 87339576) is butane;methyl 3-sulfanylpropaneperoxoate.
What is the SMILES notation for butane;methyl 3-sulfanylpropaneperoxoate?
The canonical SMILES for butane;methyl 3-sulfanylpropaneperoxoate is CCCC.COOC(=O)CCS.
What is the InChIKey of butane;methyl 3-sulfanylpropaneperoxoate?
The InChIKey is JGPVQEAWCFATTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3S.C4H10/c1-6-7-4(5)2-3-8;1-3-4-2/h8H,2-3H2,1H3;3-4H2,1-2H3.
What are the key properties of butane;methyl 3-sulfanylpropaneperoxoate?
butane;methyl 3-sulfanylpropaneperoxoate has a molecular weight of 194.30 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane;methyl 3-sulfanylpropaneperoxoate is sourced from PubChem (CID 87339576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).