About 1-methoxybutyl 3-sulfanylpropanoate
1-methoxybutyl 3-sulfanylpropanoate (PubChem CID 21275999) has the molecular formula C8H16O3S
and a molecular weight of 192.28 g/mol. Its IUPAC name is 1-methoxybutyl 3-sulfanylpropanoate.
Molecular Properties
| Compound Name | 1-methoxybutyl 3-sulfanylpropanoate |
| PubChem CID | 21275999 |
| Molecular Formula | C8H16O3S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 1-methoxybutyl 3-sulfanylpropanoate |
| SMILES | CCCC(OC)OC(=O)CCS |
| InChI | InChI=1S/C8H16O3S/c1-3-4-8(10-2)11-7(9)5-6-12/h8,12H,3-6H2,1-2H3 |
| InChIKey | FNWNKOSIZQNCCI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxybutyl 3-sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxybutyl 3-sulfanylpropanoate?
The IUPAC name of 1-methoxybutyl 3-sulfanylpropanoate (CID 21275999) is 1-methoxybutyl 3-sulfanylpropanoate.
What is the SMILES notation for 1-methoxybutyl 3-sulfanylpropanoate?
The canonical SMILES for 1-methoxybutyl 3-sulfanylpropanoate is CCCC(OC)OC(=O)CCS.
What is the InChIKey of 1-methoxybutyl 3-sulfanylpropanoate?
The InChIKey is FNWNKOSIZQNCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3S/c1-3-4-8(10-2)11-7(9)5-6-12/h8,12H,3-6H2,1-2H3.
What are the key properties of 1-methoxybutyl 3-sulfanylpropanoate?
1-methoxybutyl 3-sulfanylpropanoate has a molecular weight of 192.28 g/mol, XLogP of 1.62, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxybutyl 3-sulfanylpropanoate is sourced from PubChem (CID 21275999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).