About 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate
1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate (PubChem CID 87208268) has the molecular formula C14H26O4S2
and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate.
Molecular Properties
| Compound Name | 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate |
| PubChem CID | 87208268 |
| Molecular Formula | C14H26O4S2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate |
| SMILES | CCCC(OC(=O)CCC(C)S)OC(=O)CCC(C)S |
| InChI | InChI=1S/C14H26O4S2/c1-4-5-14(17-12(15)8-6-10(2)19)18-13(16)9-7-11(3)20/h10-11,14,19-20H,4-9H2,1-3H3 |
| InChIKey | PESCXBALTVVUFX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate?
The IUPAC name of 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate (CID 87208268) is 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate.
What is the SMILES notation for 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate?
The canonical SMILES for 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate is CCCC(OC(=O)CCC(C)S)OC(=O)CCC(C)S.
What is the InChIKey of 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate?
The InChIKey is PESCXBALTVVUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O4S2/c1-4-5-14(17-12(15)8-6-10(2)19)18-13(16)9-7-11(3)20/h10-11,14,19-20H,4-9H2,1-3H3.
What are the key properties of 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate?
1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate has a molecular weight of 322.49 g/mol, XLogP of 3.40, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-sulfanylpentanoyloxy)butyl 4-sulfanylpentanoate is sourced from PubChem (CID 87208268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).