About 1-methoxypropyl octadecanoate
1-methoxypropyl octadecanoate (PubChem CID 20514350) has the molecular formula C22H44O3
and a molecular weight of 356.59 g/mol. Its IUPAC name is 1-methoxypropyl octadecanoate.
Molecular Properties
| Compound Name | 1-methoxypropyl octadecanoate |
| PubChem CID | 20514350 |
| Molecular Formula | C22H44O3 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | 1-methoxypropyl octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OC(CC)OC |
| InChI | InChI=1S/C22H44O3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)25-22(5-2)24-3/h22H,4-20H2,1-3H3 |
| InChIKey | HTUGLJLRMGIZGX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypropyl octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropyl octadecanoate?
The IUPAC name of 1-methoxypropyl octadecanoate (CID 20514350) is 1-methoxypropyl octadecanoate.
What is the SMILES notation for 1-methoxypropyl octadecanoate?
The canonical SMILES for 1-methoxypropyl octadecanoate is CCCCCCCCCCCCCCCCCC(=O)OC(CC)OC.
What is the InChIKey of 1-methoxypropyl octadecanoate?
The InChIKey is HTUGLJLRMGIZGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)25-22(5-2)24-3/h22H,4-20H2,1-3H3.
What are the key properties of 1-methoxypropyl octadecanoate?
1-methoxypropyl octadecanoate has a molecular weight of 356.59 g/mol, XLogP of 7.17, 19 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropyl octadecanoate is sourced from PubChem (CID 20514350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).