About 1-methoxyethyl hexadecanoate
1-methoxyethyl hexadecanoate (PubChem CID 20514386) has the molecular formula C19H38O3
and a molecular weight of 314.51 g/mol. Its IUPAC name is 1-methoxyethyl hexadecanoate.
Molecular Properties
| Compound Name | 1-methoxyethyl hexadecanoate |
| PubChem CID | 20514386 |
| Molecular Formula | C19H38O3 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.28 |
| IUPAC Name | 1-methoxyethyl hexadecanoate |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC(C)OC |
| InChI | InChI=1S/C19H38O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(20)22-18(2)21-3/h18H,4-17H2,1-3H3 |
| InChIKey | QUWBNHHMVNNDMO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxyethyl hexadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxyethyl hexadecanoate?
The IUPAC name of 1-methoxyethyl hexadecanoate (CID 20514386) is 1-methoxyethyl hexadecanoate.
What is the SMILES notation for 1-methoxyethyl hexadecanoate?
The canonical SMILES for 1-methoxyethyl hexadecanoate is CCCCCCCCCCCCCCCC(=O)OC(C)OC.
What is the InChIKey of 1-methoxyethyl hexadecanoate?
The InChIKey is QUWBNHHMVNNDMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38O3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(20)22-18(2)21-3/h18H,4-17H2,1-3H3.
What are the key properties of 1-methoxyethyl hexadecanoate?
1-methoxyethyl hexadecanoate has a molecular weight of 314.51 g/mol, XLogP of 6.00, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxyethyl hexadecanoate is sourced from PubChem (CID 20514386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).