C11H20O4S2 — CID 19743124
[2,2-dimethyl-3-(3-sulfanylpropanoyloxy)propyl] 3-sulfanylpropanoate (PubChem CID 19743124) has the molecular formula C11H20O4S2 and a molecular weight of 280.41 g/mol. Its IUPAC name is [2,2-dimethyl-3-(3-sulfanylpropanoyloxy)propyl] 3-sulfanylpropanoate.
| Compound Name | [2,2-dimethyl-3-(3-sulfanylpropanoyloxy)propyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 19743124 |
| Molecular Formula | C11H20O4S2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | [2,2-dimethyl-3-(3-sulfanylpropanoyloxy)propyl] 3-sulfanylpropanoate |
| SMILES | CC(C)(COC(=O)CCS)COC(=O)CCS |
| InChI | InChI=1S/C11H20O4S2/c1-11(2,7-14-9(12)3-5-16)8-15-10(13)4-6-17/h16-17H,3-8H2,1-2H3 |
| InChIKey | IPSFAMBYWXRLSE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|