C27H48O12S5 — CID 160575600
bis(2-sulfanylethyl) butanedioate;methane;[3-(3-sulfanylpropanoyloxy)-2,2-bis(3-sulfanylpropanoyloxymethyl)propyl] butanoate (PubChem CID 160575600) has the molecular formula C27H48O12S5 and a molecular weight of 725.00 g/mol. Its IUPAC name is bis(2-sulfanylethyl) butanedioate;methane;[3-(3-sulfanylpropanoyloxy)-2,2-bis(3-sulfanylpropanoyloxymethyl)propyl] butanoate.
| Compound Name | bis(2-sulfanylethyl) butanedioate;methane;[3-(3-sulfanylpropanoyloxy)-2,2-bis(3-sulfanylpropanoyloxymethyl)propyl] butanoate |
|---|---|
| PubChem CID | 160575600 |
| Molecular Formula | C27H48O12S5 |
| Molecular Weight | 725.00 g/mol |
| Exact Mass | 724.17 |
| IUPAC Name | bis(2-sulfanylethyl) butanedioate;methane;[3-(3-sulfanylpropanoyloxy)-2,2-bis(3-sulfanylpropanoyloxymethyl)propyl] butanoate |
| SMILES | C.CCCC(=O)OCC(COC(=O)CCS)(COC(=O)CCS)COC(=O)CCS.O=C(CCC(=O)OCCS)OCCS |
| InChI | InChI=1S/C18H30O8S3.C8H14O4S2.CH4/c1-2-3-14(19)23-10-18(11-24-15(20)4-7-27,12-25-16(21)5-8-28)13-26-17(22)6-9-29;9-7(11-3-5-13)1-2-8(10)12-4-6-14;/h27-29H,2-13H2,1H3;13-14H,1-6H2;1H4 |
| InChIKey | RBCLDJJVOSPRDK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.00 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|