C18H30O7S4 — CID 88922889
[2-(4-sulfanylbut-1-en-2-yloxymethyl)-3-(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)propyl] 3-sulfanylpropanoate (PubChem CID 88922889) has the molecular formula C18H30O7S4 and a molecular weight of 486.70 g/mol. Its IUPAC name is [2-(4-sulfanylbut-1-en-2-yloxymethyl)-3-(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)propyl] 3-sulfanylpropanoate.
| Compound Name | [2-(4-sulfanylbut-1-en-2-yloxymethyl)-3-(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)propyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 88922889 |
| Molecular Formula | C18H30O7S4 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | [2-(4-sulfanylbut-1-en-2-yloxymethyl)-3-(3-sulfanylpropanoyloxy)-2-(3-sulfanylpropanoyloxymethyl)propyl] 3-sulfanylpropanoate |
| SMILES | C=C(CCS)OCC(COC(=O)CCS)(COC(=O)CCS)COC(=O)CCS |
| InChI | InChI=1S/C18H30O7S4/c1-14(2-6-26)22-10-18(11-23-15(19)3-7-27,12-24-16(20)4-8-28)13-25-17(21)5-9-29/h26-29H,1-13H2 |
| InChIKey | GNHZIRSBJROSBA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|