C13H22O5S — CID 123717356
[2-(acetyloxymethyl)-2-(ethenoxymethyl)butyl] 3-sulfanylpropanoate (PubChem CID 123717356) has the molecular formula C13H22O5S and a molecular weight of 290.38 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-2-(ethenoxymethyl)butyl] 3-sulfanylpropanoate.
| Compound Name | [2-(acetyloxymethyl)-2-(ethenoxymethyl)butyl] 3-sulfanylpropanoate |
|---|---|
| PubChem CID | 123717356 |
| Molecular Formula | C13H22O5S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | [2-(acetyloxymethyl)-2-(ethenoxymethyl)butyl] 3-sulfanylpropanoate |
| SMILES | C=COCC(CC)(COC(C)=O)COC(=O)CCS |
| InChI | InChI=1S/C13H22O5S/c1-4-13(8-16-5-2,9-17-11(3)14)10-18-12(15)6-7-19/h5,19H,2,4,6-10H2,1,3H3 |
| InChIKey | NGTFBGWFDOVDOV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|